C21H29NO8 — CID 66951297
(2S)-2-butanoyloxy-2-(butan-2-ylamino)-3-(3,4-diacetyloxyphenyl)propanoic acid (PubChem CID 66951297) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is (2S)-2-butanoyloxy-2-(butan-2-ylamino)-3-(3,4-diacetyloxyphenyl)propanoic acid.
| Compound Name | (2S)-2-butanoyloxy-2-(butan-2-ylamino)-3-(3,4-diacetyloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 66951297 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (2S)-2-butanoyloxy-2-(butan-2-ylamino)-3-(3,4-diacetyloxyphenyl)propanoic acid |
| SMILES | CCCC(=O)O[C@](Cc1ccc(OC(C)=O)c(OC(C)=O)c1)(NC(C)CC)C(=O)O |
| InChI | InChI=1S/C21H29NO8/c1-6-8-19(25)30-21(20(26)27,22-13(3)7-2)12-16-9-10-17(28-14(4)23)18(11-16)29-15(5)24/h9-11,13,22H,6-8,12H2,1-5H3,(H,26,27)/t13?,21-/m0/s1 |
| InChIKey | RXXOGJBQLQBVIW-KCSFHACMSA-N |
| XLogP | 2.59 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|