C29H45NO8 — CID 66951460
(2S)-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-2-butanoyloxy-2-(butan-2-ylamino)propanoic acid (PubChem CID 66951460) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-2-butanoyloxy-2-(butan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-2-butanoyloxy-2-(butan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66951460 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | (2S)-3-[3,4-bis(2,2-dimethylbutanoyloxy)phenyl]-2-butanoyloxy-2-(butan-2-ylamino)propanoic acid |
| SMILES | CCCC(=O)O[C@](Cc1ccc(OC(=O)C(C)(C)CC)c(OC(=O)C(C)(C)CC)c1)(NC(C)CC)C(=O)O |
| InChI | InChI=1S/C29H45NO8/c1-10-14-23(31)38-29(24(32)33,30-19(5)11-2)18-20-15-16-21(36-25(34)27(6,7)12-3)22(17-20)37-26(35)28(8,9)13-4/h15-17,19,30H,10-14,18H2,1-9H3,(H,32,33)/t19?,29-/m0/s1 |
| InChIKey | IWWAMCIOMAIMFC-NEFVBLPJSA-N |
| XLogP | 5.42 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|