C25H37NO9 — CID 66950900
(2S)-2-(butan-2-ylamino)-3-[3,4-di(butanoyloxy)phenyl]-2-propan-2-yloxycarbonyloxypropanoic acid (PubChem CID 66950900) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-2-(butan-2-ylamino)-3-[3,4-di(butanoyloxy)phenyl]-2-propan-2-yloxycarbonyloxypropanoic acid.
| Compound Name | (2S)-2-(butan-2-ylamino)-3-[3,4-di(butanoyloxy)phenyl]-2-propan-2-yloxycarbonyloxypropanoic acid |
|---|---|
| PubChem CID | 66950900 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (2S)-2-(butan-2-ylamino)-3-[3,4-di(butanoyloxy)phenyl]-2-propan-2-yloxycarbonyloxypropanoic acid |
| SMILES | CCCC(=O)Oc1ccc(C[C@](NC(C)CC)(OC(=O)OC(C)C)C(=O)O)cc1OC(=O)CCC |
| InChI | InChI=1S/C25H37NO9/c1-7-10-21(27)33-19-13-12-18(14-20(19)34-22(28)11-8-2)15-25(23(29)30,26-17(6)9-3)35-24(31)32-16(4)5/h12-14,16-17,26H,7-11,15H2,1-6H3,(H,29,30)/t17?,25-/m0/s1 |
| InChIKey | WETITHJANIPWPG-HHPDBAQJSA-N |
| XLogP | 4.37 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|