C27H41NO11 — CID 66950733
(2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid (PubChem CID 66950733) has the molecular formula C27H41NO11 and a molecular weight of 555.62 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid.
| Compound Name | (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid |
|---|---|
| PubChem CID | 66950733 |
| Molecular Formula | C27H41NO11 |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-propan-2-yloxycarbonyloxypropanoic acid |
| SMILES | CCCCOC(=O)Oc1ccc(C[C@](NC(C)CC)(OC(=O)OC(C)C)C(=O)O)cc1OC(=O)OCCCC |
| InChI | InChI=1S/C27H41NO11/c1-7-10-14-34-24(31)37-21-13-12-20(16-22(21)38-25(32)35-15-11-8-2)17-27(23(29)30,28-19(6)9-3)39-26(33)36-18(4)5/h12-13,16,18-19,28H,7-11,14-15,17H2,1-6H3,(H,29,30)/t19?,27-/m0/s1 |
| InChIKey | LQJPAEQNARFIFV-NZVRHLSZSA-N |
| XLogP | 5.59 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|