C25H37NO11 — CID 66951572
(2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-methoxycarbonyloxypropanoic acid (PubChem CID 66951572) has the molecular formula C25H37NO11 and a molecular weight of 527.57 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-methoxycarbonyloxypropanoic acid.
| Compound Name | (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-methoxycarbonyloxypropanoic acid |
|---|---|
| PubChem CID | 66951572 |
| Molecular Formula | C25H37NO11 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (2S)-3-[3,4-bis(butoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-methoxycarbonyloxypropanoic acid |
| SMILES | CCCCOC(=O)Oc1ccc(C[C@](NC(C)CC)(OC(=O)OC)C(=O)O)cc1OC(=O)OCCCC |
| InChI | InChI=1S/C25H37NO11/c1-6-9-13-33-23(30)35-19-12-11-18(15-20(19)36-24(31)34-14-10-7-2)16-25(21(27)28,26-17(4)8-3)37-22(29)32-5/h11-12,15,17,26H,6-10,13-14,16H2,1-5H3,(H,27,28)/t17?,25-/m0/s1 |
| InChIKey | GMFAIPJZPQHUEW-HHPDBAQJSA-N |
| XLogP | 4.81 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|