C26H39NO11 — CID 66950009
(2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-ethoxycarbonyloxypropanoic acid (PubChem CID 66950009) has the molecular formula C26H39NO11 and a molecular weight of 541.59 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-ethoxycarbonyloxypropanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-ethoxycarbonyloxypropanoic acid |
|---|---|
| PubChem CID | 66950009 |
| Molecular Formula | C26H39NO11 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | (2S)-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-ethoxycarbonyloxypropanoic acid |
| SMILES | CCOC(=O)O[C@](Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1)(NC(C)CC)C(=O)O |
| InChI | InChI=1S/C26H39NO11/c1-8-18(7)27-26(22(28)29,38-25(32)33-9-2)13-19-10-11-20(36-23(30)34-14-16(3)4)21(12-19)37-24(31)35-15-17(5)6/h10-12,16-18,27H,8-9,13-15H2,1-7H3,(H,28,29)/t18?,26-/m0/s1 |
| InChIKey | PLDIGSXZQBOUIL-IHZSNKTASA-N |
| XLogP | 4.91 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|