C26H40ClNO11 — CID 66951273
(2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-hexoxycarbonyloxypropanoic acid;hydrochloride (PubChem CID 66951273) has the molecular formula C26H40ClNO11 and a molecular weight of 578.06 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-hexoxycarbonyloxypropanoic acid;hydrochloride.
| Compound Name | (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-hexoxycarbonyloxypropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66951273 |
| Molecular Formula | C26H40ClNO11 |
| Molecular Weight | 578.06 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | (2S)-3-[3,4-bis(ethoxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-hexoxycarbonyloxypropanoic acid;hydrochloride |
| SMILES | CCCCCCOC(=O)O[C@](Cc1ccc(OC(=O)OCC)c(OC(=O)OCC)c1)(NC(C)CC)C(=O)O.Cl |
| InChI | InChI=1S/C26H39NO11.ClH/c1-6-10-11-12-15-35-25(32)38-26(22(28)29,27-18(5)7-2)17-19-13-14-20(36-23(30)33-8-3)21(16-19)37-24(31)34-9-4;/h13-14,16,18,27H,6-12,15,17H2,1-5H3,(H,28,29);1H/t18?,26-;/m0./s1 |
| InChIKey | FVALITGPTJWLJP-PABXKYCNSA-N |
| XLogP | 5.62 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.06 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|