C24H35NO8 — CID 66949502
(2S)-2-(butan-2-ylamino)-3-[3,4-di(propanoyloxy)phenyl]-2-(3-methylbutanoyloxy)propanoic acid (PubChem CID 66949502) has the molecular formula C24H35NO8 and a molecular weight of 465.54 g/mol. Its IUPAC name is (2S)-2-(butan-2-ylamino)-3-[3,4-di(propanoyloxy)phenyl]-2-(3-methylbutanoyloxy)propanoic acid.
| Compound Name | (2S)-2-(butan-2-ylamino)-3-[3,4-di(propanoyloxy)phenyl]-2-(3-methylbutanoyloxy)propanoic acid |
|---|---|
| PubChem CID | 66949502 |
| Molecular Formula | C24H35NO8 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (2S)-2-(butan-2-ylamino)-3-[3,4-di(propanoyloxy)phenyl]-2-(3-methylbutanoyloxy)propanoic acid |
| SMILES | CCC(=O)Oc1ccc(C[C@](NC(C)CC)(OC(=O)CC(C)C)C(=O)O)cc1OC(=O)CC |
| InChI | InChI=1S/C24H35NO8/c1-7-16(6)25-24(23(29)30,33-22(28)12-15(4)5)14-17-10-11-18(31-20(26)8-2)19(13-17)32-21(27)9-3/h10-11,13,15-16,25H,7-9,12,14H2,1-6H3,(H,29,30)/t16?,24-/m0/s1 |
| InChIKey | WYQROYCPMLSYTJ-ODOSRFNGSA-N |
| XLogP | 3.62 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|