C24H35NO9 — CID 66942908
(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-methoxycarbonyloxy-2-(propan-2-ylamino)propanoic acid (PubChem CID 66942908) has the molecular formula C24H35NO9 and a molecular weight of 481.54 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-methoxycarbonyloxy-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-methoxycarbonyloxy-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66942908 |
| Molecular Formula | C24H35NO9 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | (2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-methoxycarbonyloxy-2-(propan-2-ylamino)propanoic acid |
| SMILES | COC(=O)O[C@](Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1)(NC(C)C)C(=O)O |
| InChI | InChI=1S/C24H35NO9/c1-14(2)25-24(18(26)27,34-21(30)31-9)13-15-10-11-16(32-19(28)22(3,4)5)17(12-15)33-20(29)23(6,7)8/h10-12,14,25H,13H2,1-9H3,(H,26,27)/t24-/m0/s1 |
| InChIKey | NYESFYVIXWKXSM-DEOSSOPVSA-N |
| XLogP | 3.69 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|