C22H31NO10 — CID 66942612
(2S)-2-acetyloxy-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(propan-2-ylamino)propanoic acid (PubChem CID 66942612) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is (2S)-2-acetyloxy-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-2-acetyloxy-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66942612 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (2S)-2-acetyloxy-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(propan-2-ylamino)propanoic acid |
| SMILES | CCCOC(=O)Oc1ccc(C[C@](NC(C)C)(OC(C)=O)C(=O)O)cc1OC(=O)OCCC |
| InChI | InChI=1S/C22H31NO10/c1-6-10-29-20(27)31-17-9-8-16(12-18(17)32-21(28)30-11-7-2)13-22(19(25)26,23-14(3)4)33-15(5)24/h8-9,12,14,23H,6-7,10-11,13H2,1-5H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | JUGQPKRWPCNZRF-QFIPXVFZSA-N |
| XLogP | 3.42 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|