C30H47NO11 — CID 66943579
(2S)-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-2-(2,2-dimethylpropoxycarbonyloxy)-2-(propan-2-ylamino)propanoic acid (PubChem CID 66943579) has the molecular formula C30H47NO11 and a molecular weight of 597.70 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-2-(2,2-dimethylpropoxycarbonyloxy)-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-2-(2,2-dimethylpropoxycarbonyloxy)-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66943579 |
| Molecular Formula | C30H47NO11 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | (2S)-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]-2-(2,2-dimethylpropoxycarbonyloxy)-2-(propan-2-ylamino)propanoic acid |
| SMILES | CC(C)CCOC(=O)Oc1ccc(C[C@](NC(C)C)(OC(=O)OCC(C)(C)C)C(=O)O)cc1OC(=O)OCCC(C)C |
| InChI | InChI=1S/C30H47NO11/c1-19(2)12-14-37-26(34)40-23-11-10-22(16-24(23)41-27(35)38-15-13-20(3)4)17-30(25(32)33,31-21(5)6)42-28(36)39-18-29(7,8)9/h10-11,16,19-21,31H,12-15,17-18H2,1-9H3,(H,32,33)/t30-/m0/s1 |
| InChIKey | GIXBBZZLRUXKJR-PMERELPUSA-N |
| XLogP | 6.33 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|