C32H49NO10 — CID 66951247
(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-(cyclohexanecarbonyloxy)propanoic acid (PubChem CID 66951247) has the molecular formula C32H49NO10 and a molecular weight of 607.74 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-(cyclohexanecarbonyloxy)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-(cyclohexanecarbonyloxy)propanoic acid |
|---|---|
| PubChem CID | 66951247 |
| Molecular Formula | C32H49NO10 |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.34 |
| IUPAC Name | (2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-2-(butan-2-ylamino)-2-(cyclohexanecarbonyloxy)propanoic acid |
| SMILES | CCCC(C)OC(=O)Oc1ccc(C[C@](NC(C)CC)(OC(=O)C2CCCCC2)C(=O)O)cc1OC(=O)OC(C)CCC |
| InChI | InChI=1S/C32H49NO10/c1-7-13-22(5)39-30(37)41-26-18-17-24(19-27(26)42-31(38)40-23(6)14-8-2)20-32(29(35)36,33-21(4)9-3)43-28(34)25-15-11-10-12-16-25/h17-19,21-23,25,33H,7-16,20H2,1-6H3,(H,35,36)/t21?,22?,23?,32-/m0/s1 |
| InChIKey | RFBOSIKFAHBHNO-MLPPWSQZSA-N |
| XLogP | 6.93 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|