C29H43NO8 — CID 66946501
(2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(cyclohexanecarbonyloxy)-2-(propan-2-ylamino)propanoic acid (PubChem CID 66946501) has the molecular formula C29H43NO8 and a molecular weight of 533.66 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(cyclohexanecarbonyloxy)-2-(propan-2-ylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(cyclohexanecarbonyloxy)-2-(propan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 66946501 |
| Molecular Formula | C29H43NO8 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(cyclohexanecarbonyloxy)-2-(propan-2-ylamino)propanoic acid |
| SMILES | CCC(C)C(=O)Oc1ccc(C[C@](NC(C)C)(OC(=O)C2CCCCC2)C(=O)O)cc1OC(=O)C(C)CC |
| InChI | InChI=1S/C29H43NO8/c1-7-19(5)25(31)36-23-15-14-21(16-24(23)37-26(32)20(6)8-2)17-29(28(34)35,30-18(3)4)38-27(33)22-12-10-9-11-13-22/h14-16,18-20,22,30H,7-13,17H2,1-6H3,(H,34,35)/t19?,20?,29-/m0/s1 |
| InChIKey | QXFIZRQSYSGZBW-GBULVANGSA-N |
| XLogP | 5.03 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|