C28H43NO8 — CID 66950624
(4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2,2-dimethylbutanoyloxy)pentanoic acid (PubChem CID 66950624) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2,2-dimethylbutanoyloxy)pentanoic acid.
| Compound Name | (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2,2-dimethylbutanoyloxy)pentanoic acid |
|---|---|
| PubChem CID | 66950624 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | (4S)-2-amino-2-[[3,4-bis(3-methylbutanoyloxy)phenyl]methyl]-4-(2,2-dimethylbutanoyloxy)pentanoic acid |
| SMILES | CCC(C)(C)C(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)CC(C)C)c(OC(=O)CC(C)C)c1)C(=O)O |
| InChI | InChI=1S/C28H43NO8/c1-9-27(7,8)26(34)35-19(6)15-28(29,25(32)33)16-20-10-11-21(36-23(30)12-17(2)3)22(14-20)37-24(31)13-18(4)5/h10-11,14,17-19H,9,12-13,15-16,29H2,1-8H3,(H,32,33)/t19-,28?/m0/s1 |
| InChIKey | RXHXVFALOULQEZ-ZAFBDEJNSA-N |
| XLogP | 4.67 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|