C26H39NO10 — CID 91243418
[(2S,3S)-3-propanoyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]propanoate (PubChem CID 91243418) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is [(2S,3S)-3-propanoyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S,3S)-3-propanoyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 91243418 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | [(2S,3S)-3-propanoyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]propanoate |
| SMILES | CCC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C26H39NO10/c1-8-23(28)34-17(6)18(7)35-24(29)20(27)11-19-9-10-21(36-25(30)32-13-15(2)3)22(12-19)37-26(31)33-14-16(4)5/h9-10,12,15-18,20H,8,11,13-14,27H2,1-7H3/t17-,18-,20-/m0/s1 |
| InChIKey | GNNFUYMZXXWKEP-BJLQDIEVSA-N |
| XLogP | 4.17 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|