C27H41NO10 — CID 91073355
[(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate (PubChem CID 91073355) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 91073355 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
| SMILES | CCC(=O)O[C@@H](C)COC(=O)[C@@H](N)Cc1ccc(OC(=O)OCCC(C)C)c(OC(=O)OCCC(C)C)c1 |
| InChI | InChI=1S/C27H41NO10/c1-7-24(29)36-19(6)16-35-25(30)21(28)14-20-8-9-22(37-26(31)33-12-10-17(2)3)23(15-20)38-27(32)34-13-11-18(4)5/h8-9,15,17-19,21H,7,10-14,16,28H2,1-6H3/t19-,21-/m0/s1 |
| InChIKey | LBIZJDIQONHETO-FPOVZHCZSA-N |
| XLogP | 4.56 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|