C30H47NO10 — CID 91026182
[(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 4-methylpentanoate (PubChem CID 91026182) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 4-methylpentanoate.
| Compound Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 91026182 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [(2S)-1-[(2S)-2-amino-3-[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]propanoyl]oxypropan-2-yl] 4-methylpentanoate |
| SMILES | CCC(C)COC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)CCC(C)C)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C30H47NO10/c1-8-20(5)16-37-29(34)40-25-12-11-23(15-26(25)41-30(35)38-17-21(6)9-2)14-24(31)28(33)36-18-22(7)39-27(32)13-10-19(3)4/h11-12,15,19-22,24H,8-10,13-14,16-18,31H2,1-7H3/t20?,21?,22-,24-/m0/s1 |
| InChIKey | UPMMKJHYFQLMKU-AELPEBTASA-N |
| XLogP | 5.59 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|