C25H37NO10 — CID 90808249
[(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]propanoate (PubChem CID 90808249) has the molecular formula C25H37NO10 and a molecular weight of 511.57 g/mol. Its IUPAC name is [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 90808249 |
| Molecular Formula | C25H37NO10 |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | [(2S)-2-propanoyloxypropyl] (2S)-2-amino-3-[3,4-bis(butan-2-yloxycarbonyloxy)phenyl]propanoate |
| SMILES | CCC(=O)O[C@@H](C)COC(=O)[C@@H](N)Cc1ccc(OC(=O)OC(C)CC)c(OC(=O)OC(C)CC)c1 |
| InChI | InChI=1S/C25H37NO10/c1-7-15(4)33-24(29)35-20-11-10-18(13-21(20)36-25(30)34-16(5)8-2)12-19(26)23(28)31-14-17(6)32-22(27)9-3/h10-11,13,15-17,19H,7-9,12,14,26H2,1-6H3/t15?,16?,17-,19-/m0/s1 |
| InChIKey | DNQMDGWOENCYFJ-AKSNENBUSA-N |
| XLogP | 4.07 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|