C28H43NO11 — CID 90844764
[(2S)-2-propan-2-yloxycarbonyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate (PubChem CID 90844764) has the molecular formula C28H43NO11 and a molecular weight of 569.65 g/mol. Its IUPAC name is [(2S)-2-propan-2-yloxycarbonyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S)-2-propan-2-yloxycarbonyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 90844764 |
| Molecular Formula | C28H43NO11 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.28 |
| IUPAC Name | [(2S)-2-propan-2-yloxycarbonyloxypropyl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
| SMILES | CC(C)CCOC(=O)Oc1ccc(C[C@H](N)C(=O)OC[C@H](C)OC(=O)OC(C)C)cc1OC(=O)OCCC(C)C |
| InChI | InChI=1S/C28H43NO11/c1-17(2)10-12-34-26(31)39-23-9-8-21(15-24(23)40-27(32)35-13-11-18(3)4)14-22(29)25(30)36-16-20(7)38-28(33)37-19(5)6/h8-9,15,17-20,22H,10-14,16,29H2,1-7H3/t20-,22-/m0/s1 |
| InChIKey | CNXPUVFVWIOIFF-UNMCSNQZSA-N |
| XLogP | 5.17 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|