C31H49NO11 — CID 90798955
[(2S,3S)-3-pentan-2-yloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate (PubChem CID 90798955) has the molecular formula C31H49NO11 and a molecular weight of 611.73 g/mol. Its IUPAC name is [(2S,3S)-3-pentan-2-yloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate.
| Compound Name | [(2S,3S)-3-pentan-2-yloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 90798955 |
| Molecular Formula | C31H49NO11 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.33 |
| IUPAC Name | [(2S,3S)-3-pentan-2-yloxycarbonyloxybutan-2-yl] (2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoate |
| SMILES | CCCC(C)OC(=O)O[C@@H](C)[C@H](C)OC(=O)[C@@H](N)Cc1ccc(OC(=O)OCCC(C)C)c(OC(=O)OCCC(C)C)c1 |
| InChI | InChI=1S/C31H49NO11/c1-9-10-21(6)39-31(36)41-23(8)22(7)40-28(33)25(32)17-24-11-12-26(42-29(34)37-15-13-19(2)3)27(18-24)43-30(35)38-16-14-20(4)5/h11-12,18-23,25H,9-10,13-17,32H2,1-8H3/t21?,22-,23-,25-/m0/s1 |
| InChIKey | VEWDTXCEPBHWHJ-YTJMMMLMSA-N |
| XLogP | 6.34 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|