C32H43NO10 — CID 91075302
[(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] benzoate (PubChem CID 91075302) has the molecular formula C32H43NO10 and a molecular weight of 601.69 g/mol. Its IUPAC name is [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] benzoate.
| Compound Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 91075302 |
| Molecular Formula | C32H43NO10 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | [(2S,3S)-3-[(2S)-2-amino-3-[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]propanoyl]oxybutan-2-yl] benzoate |
| SMILES | CC(C)CCOC(=O)Oc1ccc(C[C@H](N)C(=O)O[C@@H](C)[C@H](C)OC(=O)c2ccccc2)cc1OC(=O)OCCC(C)C |
| InChI | InChI=1S/C32H43NO10/c1-20(2)14-16-38-31(36)42-27-13-12-24(19-28(27)43-32(37)39-17-15-21(3)4)18-26(33)30(35)41-23(6)22(5)40-29(34)25-10-8-7-9-11-25/h7-13,19-23,26H,14-18,33H2,1-6H3/t22-,23-,26-/m0/s1 |
| InChIKey | DSAQLQDHRDVIAK-FXSPECFOSA-N |
| XLogP | 5.86 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|