C32H43NO10 — CID 66950245
[(4S)-4-amino-4-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate (PubChem CID 66950245) has the molecular formula C32H43NO10 and a molecular weight of 601.69 g/mol. Its IUPAC name is [(4S)-4-amino-4-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate.
| Compound Name | [(4S)-4-amino-4-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate |
|---|---|
| PubChem CID | 66950245 |
| Molecular Formula | C32H43NO10 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | [(4S)-4-amino-4-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-5-methoxy-5-oxopentan-2-yl] benzoate |
| SMILES | COC(=O)[C@](N)(Cc1ccc(OC(=O)OCCC(C)C)c(OC(=O)OCCC(C)C)c1)CC(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H43NO10/c1-21(2)14-16-39-30(36)42-26-13-12-24(18-27(26)43-31(37)40-17-15-22(3)4)20-32(33,29(35)38-6)19-23(5)41-28(34)25-10-8-7-9-11-25/h7-13,18,21-23H,14-17,19-20,33H2,1-6H3/t23?,32-/m1/s1 |
| InChIKey | MBQLBUHXOLAJIR-CXMIBLNGSA-N |
| XLogP | 5.86 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|