C28H43NO10 — CID 66943147
methyl (2S)-2-amino-2-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)butanoate (PubChem CID 66943147) has the molecular formula C28H43NO10 and a molecular weight of 553.65 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)butanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)butanoate |
|---|---|
| PubChem CID | 66943147 |
| Molecular Formula | C28H43NO10 |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.29 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(3-methylbutoxycarbonyloxy)phenyl]methyl]-4-(2-methylpropanoyloxy)butanoate |
| SMILES | COC(=O)[C@@](N)(CCOC(=O)C(C)C)Cc1ccc(OC(=O)OCCC(C)C)c(OC(=O)OCCC(C)C)c1 |
| InChI | InChI=1S/C28H43NO10/c1-18(2)10-13-36-26(32)38-22-9-8-21(16-23(22)39-27(33)37-14-11-19(3)4)17-28(29,25(31)34-7)12-15-35-24(30)20(5)6/h8-9,16,18-20H,10-15,17,29H2,1-7H3/t28-/m1/s1 |
| InChIKey | RIRULPWOHLCLTP-MUUNZHRXSA-N |
| XLogP | 4.81 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|