C24H35NO10 — CID 66945719
[(3S)-3-amino-3-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 2,3-dimethylbutanoate (PubChem CID 66945719) has the molecular formula C24H35NO10 and a molecular weight of 497.54 g/mol. Its IUPAC name is [(3S)-3-amino-3-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 2,3-dimethylbutanoate.
| Compound Name | [(3S)-3-amino-3-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 66945719 |
| Molecular Formula | C24H35NO10 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | [(3S)-3-amino-3-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 2,3-dimethylbutanoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@](N)(CCOC(=O)C(C)C(C)C)C(=O)OC)cc1OC(=O)OCC |
| InChI | InChI=1S/C24H35NO10/c1-7-31-22(28)34-18-10-9-17(13-19(18)35-23(29)32-8-2)14-24(25,21(27)30-6)11-12-33-20(26)16(5)15(3)4/h9-10,13,15-16H,7-8,11-12,14,25H2,1-6H3/t16?,24-/m1/s1 |
| InChIKey | HGEVDWUCPOXIKH-OODIQHKMSA-N |
| XLogP | 3.40 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|