C30H47NO10 — CID 91168075
[3-amino-3-[[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] (2S)-2,3-dimethylbutanoate (PubChem CID 91168075) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [3-amino-3-[[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] (2S)-2,3-dimethylbutanoate.
| Compound Name | [3-amino-3-[[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] (2S)-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 91168075 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [3-amino-3-[[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] (2S)-2,3-dimethylbutanoate |
| SMILES | COC(=O)C(N)(CCOC(=O)[C@@H](C)C(C)C)Cc1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1 |
| InChI | InChI=1S/C30H47NO10/c1-17(2)20(7)26(32)37-14-13-30(31,27(33)36-10)16-23-11-12-24(40-28(34)38-21(8)18(3)4)25(15-23)41-29(35)39-22(9)19(5)6/h11-12,15,17-22H,13-14,16,31H2,1-10H3/t20-,21?,22?,30?/m0/s1 |
| InChIKey | OAMDROVPDAOODL-OBZDKZKPSA-N |
| XLogP | 5.44 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|