C25H37NO11 — CID 66946445
methyl (2S)-2-amino-2-[[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate (PubChem CID 66946445) has the molecular formula C25H37NO11 and a molecular weight of 527.57 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate |
|---|---|
| PubChem CID | 66946445 |
| Molecular Formula | C25H37NO11 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate |
| SMILES | COC(=O)[C@@](N)(CCOC(=O)OCC(C)C)Cc1ccc(OC(=O)OC(C)C)c(OC(=O)OC(C)C)c1 |
| InChI | InChI=1S/C25H37NO11/c1-15(2)14-33-22(28)32-11-10-25(26,21(27)31-7)13-18-8-9-19(36-23(29)34-16(3)4)20(12-18)37-24(30)35-17(5)6/h8-9,12,15-17H,10-11,13-14,26H2,1-7H3/t25-/m1/s1 |
| InChIKey | CBHQWGQHZUBUCE-RUZDIDTESA-N |
| XLogP | 4.15 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|