C25H37NO9 — CID 77203288
methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate (PubChem CID 77203288) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate.
| Compound Name | methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate |
|---|---|
| PubChem CID | 77203288 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-(2-methylpropoxycarbonyloxy)butanoate |
| SMILES | CCCC(=O)Oc1ccc(CC(N)(CCOC(=O)OCC(C)C)C(=O)OC)cc1OC(=O)CCC |
| InChI | InChI=1S/C25H37NO9/c1-6-8-21(27)34-19-11-10-18(14-20(19)35-22(28)9-7-2)15-25(26,23(29)31-5)12-13-32-24(30)33-16-17(3)4/h10-11,14,17H,6-9,12-13,15-16,26H2,1-5H3 |
| InChIKey | VNJDBAUEAJTQMP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|