C27H41NO10 — CID 66943125
methyl (2S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(2,2-dimethylpropanoyloxy)butanoate (PubChem CID 66943125) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(2,2-dimethylpropanoyloxy)butanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(2,2-dimethylpropanoyloxy)butanoate |
|---|---|
| PubChem CID | 66943125 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylpropoxycarbonyloxy)phenyl]methyl]-4-(2,2-dimethylpropanoyloxy)butanoate |
| SMILES | COC(=O)[C@@](N)(CCOC(=O)C(C)(C)C)Cc1ccc(OC(=O)OCC(C)C)c(OC(=O)OCC(C)C)c1 |
| InChI | InChI=1S/C27H41NO10/c1-17(2)15-35-24(31)37-20-10-9-19(13-21(20)38-25(32)36-16-18(3)4)14-27(28,23(30)33-8)11-12-34-22(29)26(5,6)7/h9-10,13,17-18H,11-12,14-16,28H2,1-8H3/t27-/m1/s1 |
| InChIKey | YENNAEDPBMNNIY-HHHXNRCGSA-N |
| XLogP | 4.42 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|