C30H47NO10 — CID 66942551
[(3S)-3-amino-3-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3,3-dimethylbutanoate (PubChem CID 66942551) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [(3S)-3-amino-3-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3,3-dimethylbutanoate.
| Compound Name | [(3S)-3-amino-3-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 66942551 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [(3S)-3-amino-3-[[3,4-bis(2-methylbutoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3,3-dimethylbutanoate |
| SMILES | CCC(C)COC(=O)Oc1ccc(C[C@](N)(CCOC(=O)CC(C)(C)C)C(=O)OC)cc1OC(=O)OCC(C)CC |
| InChI | InChI=1S/C30H47NO10/c1-9-20(3)18-38-27(34)40-23-12-11-22(15-24(23)41-28(35)39-19-21(4)10-2)16-30(31,26(33)36-8)13-14-37-25(32)17-29(5,6)7/h11-12,15,20-21H,9-10,13-14,16-19,31H2,1-8H3/t20?,21?,30-/m1/s1 |
| InChIKey | KLNXQVXWGBVQPT-MWZSVNGBSA-N |
| XLogP | 5.59 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|