C26H39NO9 — CID 66943243
methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-[(2S)-2-methylbutoxy]carbonyloxybutanoate (PubChem CID 66943243) has the molecular formula C26H39NO9 and a molecular weight of 509.60 g/mol. Its IUPAC name is methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-[(2S)-2-methylbutoxy]carbonyloxybutanoate.
| Compound Name | methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-[(2S)-2-methylbutoxy]carbonyloxybutanoate |
|---|---|
| PubChem CID | 66943243 |
| Molecular Formula | C26H39NO9 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | methyl 2-amino-2-[[3,4-di(butanoyloxy)phenyl]methyl]-4-[(2S)-2-methylbutoxy]carbonyloxybutanoate |
| SMILES | CCCC(=O)Oc1ccc(CC(N)(CCOC(=O)OC[C@@H](C)CC)C(=O)OC)cc1OC(=O)CCC |
| InChI | InChI=1S/C26H39NO9/c1-6-9-22(28)35-20-12-11-19(15-21(20)36-23(29)10-7-2)16-26(27,24(30)32-5)13-14-33-25(31)34-17-18(4)8-3/h11-12,15,18H,6-10,13-14,16-17,27H2,1-5H3/t18-,26?/m0/s1 |
| InChIKey | VARGBEGNPFFIAA-MDYZWHIJSA-N |
| XLogP | 4.10 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|