C22H31NO10 — CID 66943676
[(3S)-3-amino-3-[[3,4-bis(methoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3-methylpentanoate (PubChem CID 66943676) has the molecular formula C22H31NO10 and a molecular weight of 469.49 g/mol. Its IUPAC name is [(3S)-3-amino-3-[[3,4-bis(methoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3-methylpentanoate.
| Compound Name | [(3S)-3-amino-3-[[3,4-bis(methoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3-methylpentanoate |
|---|---|
| PubChem CID | 66943676 |
| Molecular Formula | C22H31NO10 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | [(3S)-3-amino-3-[[3,4-bis(methoxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OCC[C@@](N)(Cc1ccc(OC(=O)OC)c(OC(=O)OC)c1)C(=O)OC |
| InChI | InChI=1S/C22H31NO10/c1-6-14(2)11-18(24)31-10-9-22(23,19(25)28-3)13-15-7-8-16(32-20(26)29-4)17(12-15)33-21(27)30-5/h7-8,12,14H,6,9-11,13,23H2,1-5H3/t14?,22-/m1/s1 |
| InChIKey | YECQTNVAIWCCAC-PSRIUPCASA-N |
| XLogP | 2.76 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|