C23H33NO11 — CID 66945710
methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-[(2S)-butan-2-yl]oxycarbonyloxybutanoate (PubChem CID 66945710) has the molecular formula C23H33NO11 and a molecular weight of 499.51 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-[(2S)-butan-2-yl]oxycarbonyloxybutanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-[(2S)-butan-2-yl]oxycarbonyloxybutanoate |
|---|---|
| PubChem CID | 66945710 |
| Molecular Formula | C23H33NO11 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-4-[(2S)-butan-2-yl]oxycarbonyloxybutanoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@](N)(CCOC(=O)O[C@@H](C)CC)C(=O)OC)cc1OC(=O)OCC |
| InChI | InChI=1S/C23H33NO11/c1-6-15(4)33-22(28)32-12-11-23(24,19(25)29-5)14-16-9-10-17(34-20(26)30-7-2)18(13-16)35-21(27)31-8-3/h9-10,13,15H,6-8,11-12,14,24H2,1-5H3/t15-,23+/m0/s1 |
| InChIKey | GNONRSZFDQWMJQ-NPMXOYFQSA-N |
| XLogP | 3.51 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|