C23H33NO10 — CID 66951522
methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-(2-methylpropanoyloxy)pentanoate (PubChem CID 66951522) has the molecular formula C23H33NO10 and a molecular weight of 483.51 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-(2-methylpropanoyloxy)pentanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-(2-methylpropanoyloxy)pentanoate |
|---|---|
| PubChem CID | 66951522 |
| Molecular Formula | C23H33NO10 |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(ethoxycarbonyloxy)phenyl]methyl]-5-(2-methylpropanoyloxy)pentanoate |
| SMILES | CCOC(=O)Oc1ccc(C[C@@](N)(CCCOC(=O)C(C)C)C(=O)OC)cc1OC(=O)OCC |
| InChI | InChI=1S/C23H33NO10/c1-6-30-21(27)33-17-10-9-16(13-18(17)34-22(28)31-7-2)14-23(24,20(26)29-5)11-8-12-32-19(25)15(3)4/h9-10,13,15H,6-8,11-12,14,24H2,1-5H3/t23-/m0/s1 |
| InChIKey | VDOMIHRXJKAXPH-QHCPKHFHSA-N |
| XLogP | 3.15 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|