C30H47NO11 — CID 66947703
methyl (2S)-2-amino-2-[[3,4-bis(pentoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutoxycarbonyloxy)butanoate (PubChem CID 66947703) has the molecular formula C30H47NO11 and a molecular weight of 597.70 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(pentoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutoxycarbonyloxy)butanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(pentoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutoxycarbonyloxy)butanoate |
|---|---|
| PubChem CID | 66947703 |
| Molecular Formula | C30H47NO11 |
| Molecular Weight | 597.70 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(pentoxycarbonyloxy)phenyl]methyl]-4-(3-methylbutoxycarbonyloxy)butanoate |
| SMILES | CCCCCOC(=O)Oc1ccc(C[C@](N)(CCOC(=O)OCCC(C)C)C(=O)OC)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C30H47NO11/c1-6-8-10-16-37-28(34)41-24-13-12-23(20-25(24)42-29(35)38-17-11-9-7-2)21-30(31,26(32)36-5)15-19-40-27(33)39-18-14-22(3)4/h12-13,20,22H,6-11,14-19,21,31H2,1-5H3/t30-/m1/s1 |
| InChIKey | XFZXDPPZTWIESC-SSEXGKCCSA-N |
| XLogP | 6.10 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.70 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|