C28H43NO9 — CID 66947717
methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxybutanoate (PubChem CID 66947717) has the molecular formula C28H43NO9 and a molecular weight of 537.65 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxybutanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxybutanoate |
|---|---|
| PubChem CID | 66947717 |
| Molecular Formula | C28H43NO9 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxybutanoate |
| SMILES | CCCCCOC(=O)OCC[C@@](N)(Cc1ccc(OC(=O)C(C)CC)c(OC(=O)C(C)CC)c1)C(=O)OC |
| InChI | InChI=1S/C28H43NO9/c1-7-10-11-15-35-27(33)36-16-14-28(29,26(32)34-6)18-21-12-13-22(37-24(30)19(4)8-2)23(17-21)38-25(31)20(5)9-3/h12-13,17,19-20H,7-11,14-16,18,29H2,1-6H3/t19?,20?,28-/m1/s1 |
| InChIKey | TYAAWLGAYFGRPU-KGBCOHSOSA-N |
| XLogP | 4.74 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|