C27H41NO9 — CID 66950423
methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoate (PubChem CID 66950423) has the molecular formula C27H41NO9 and a molecular weight of 523.62 g/mol. Its IUPAC name is methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoate.
| Compound Name | methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoate |
|---|---|
| PubChem CID | 66950423 |
| Molecular Formula | C27H41NO9 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | methyl (4S)-2-amino-2-[[3,4-bis(2-methylpropanoyloxy)phenyl]methyl]-4-pentoxycarbonyloxypentanoate |
| SMILES | CCCCCOC(=O)O[C@@H](C)CC(N)(Cc1ccc(OC(=O)C(C)C)c(OC(=O)C(C)C)c1)C(=O)OC |
| InChI | InChI=1S/C27H41NO9/c1-8-9-10-13-34-26(32)35-19(6)15-27(28,25(31)33-7)16-20-11-12-21(36-23(29)17(2)3)22(14-20)37-24(30)18(4)5/h11-12,14,17-19H,8-10,13,15-16,28H2,1-7H3/t19-,27?/m0/s1 |
| InChIKey | QVXXIYHZLFJUHN-JDEXWRGDSA-N |
| XLogP | 4.34 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|