C27H41NO8 — CID 66945037
methyl (2S)-2-amino-2-[[3,4-di(pentanoyloxy)phenyl]methyl]-4-(2-methylbutanoyloxy)butanoate (PubChem CID 66945037) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-di(pentanoyloxy)phenyl]methyl]-4-(2-methylbutanoyloxy)butanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-di(pentanoyloxy)phenyl]methyl]-4-(2-methylbutanoyloxy)butanoate |
|---|---|
| PubChem CID | 66945037 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-di(pentanoyloxy)phenyl]methyl]-4-(2-methylbutanoyloxy)butanoate |
| SMILES | CCCCC(=O)Oc1ccc(C[C@](N)(CCOC(=O)C(C)CC)C(=O)OC)cc1OC(=O)CCCC |
| InChI | InChI=1S/C27H41NO8/c1-6-9-11-23(29)35-21-14-13-20(17-22(21)36-24(30)12-10-7-2)18-27(28,26(32)33-5)15-16-34-25(31)19(4)8-3/h13-14,17,19H,6-12,15-16,18,28H2,1-5H3/t19?,27-/m1/s1 |
| InChIKey | HTSSVQJKCQDKJL-MLARANPPSA-N |
| XLogP | 4.27 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|