C29H45NO10 — CID 66946817
methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-pentanoyloxybutanoate (PubChem CID 66946817) has the molecular formula C29H45NO10 and a molecular weight of 567.68 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-pentanoyloxybutanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-pentanoyloxybutanoate |
|---|---|
| PubChem CID | 66946817 |
| Molecular Formula | C29H45NO10 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]methyl]-4-pentanoyloxybutanoate |
| SMILES | CCCCC(=O)OCC[C@@](N)(Cc1ccc(OC(=O)OC(C)(C)CC)c(OC(=O)OC(C)(C)CC)c1)C(=O)OC |
| InChI | InChI=1S/C29H45NO10/c1-9-12-13-23(31)36-17-16-29(30,24(32)35-8)19-20-14-15-21(37-25(33)39-27(4,5)10-2)22(18-20)38-26(34)40-28(6,7)11-3/h14-15,18H,9-13,16-17,19,30H2,1-8H3/t29-/m1/s1 |
| InChIKey | IVRRNISHIIWYPH-GDLZYMKVSA-N |
| XLogP | 5.63 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|