C21H29NO8 — CID 66946055
methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-propanoyloxybutanoate (PubChem CID 66946055) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-propanoyloxybutanoate.
| Compound Name | methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-propanoyloxybutanoate |
|---|---|
| PubChem CID | 66946055 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | methyl (2S)-2-amino-2-[[3,4-di(propanoyloxy)phenyl]methyl]-4-propanoyloxybutanoate |
| SMILES | CCC(=O)OCC[C@@](N)(Cc1ccc(OC(=O)CC)c(OC(=O)CC)c1)C(=O)OC |
| InChI | InChI=1S/C21H29NO8/c1-5-17(23)28-11-10-21(22,20(26)27-4)13-14-8-9-15(29-18(24)6-2)16(12-14)30-19(25)7-3/h8-9,12H,5-7,10-11,13,22H2,1-4H3/t21-/m1/s1 |
| InChIKey | GBBVGTUORHZVHW-OAQYLSRUSA-N |
| XLogP | 2.07 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|