C31H41NO10 — CID 91098415
[(3S)-3-amino-3-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] benzoate (PubChem CID 91098415) has the molecular formula C31H41NO10 and a molecular weight of 587.67 g/mol. Its IUPAC name is [(3S)-3-amino-3-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] benzoate.
| Compound Name | [(3S)-3-amino-3-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] benzoate |
|---|---|
| PubChem CID | 91098415 |
| Molecular Formula | C31H41NO10 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | [(3S)-3-amino-3-[[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]methyl]-4-methoxy-4-oxobutyl] benzoate |
| SMILES | CCCC(C)OC(=O)Oc1ccc(C[C@](N)(CCOC(=O)c2ccccc2)C(=O)OC)cc1OC(=O)OC(C)CCC |
| InChI | InChI=1S/C31H41NO10/c1-6-11-21(3)39-29(35)41-25-16-15-23(19-26(25)42-30(36)40-22(4)12-7-2)20-31(32,28(34)37-5)17-18-38-27(33)24-13-9-8-10-14-24/h8-10,13-16,19,21-22H,6-7,11-12,17-18,20,32H2,1-5H3/t21?,22?,31-/m1/s1 |
| InChIKey | AMOSFIVLSGTAEG-YSBILVTJSA-N |
| XLogP | 5.75 |
| TPSA | 149.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|