C31H41NO10 — CID 66944875
2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl benzoate (PubChem CID 66944875) has the molecular formula C31H41NO10 and a molecular weight of 587.67 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl benzoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl benzoate |
|---|---|
| PubChem CID | 66944875 |
| Molecular Formula | C31H41NO10 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(pentan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl benzoate |
| SMILES | CCCC(C)OC(=O)Oc1ccc(C[C@H](NCCOC(=O)c2ccccc2)C(=O)OC)cc1OC(=O)OC(C)CCC |
| InChI | InChI=1S/C31H41NO10/c1-6-11-21(3)39-30(35)41-26-16-15-23(20-27(26)42-31(36)40-22(4)12-7-2)19-25(29(34)37-5)32-17-18-38-28(33)24-13-9-8-10-14-24/h8-10,13-16,20-22,25,32H,6-7,11-12,17-19H2,1-5H3/t21?,22?,25-/m0/s1 |
| InChIKey | XOLMPYDPIIZWBY-OWWUNANSSA-N |
| XLogP | 5.63 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|