C32H43NO10 — CID 66951366
1-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl benzoate (PubChem CID 66951366) has the molecular formula C32H43NO10 and a molecular weight of 601.69 g/mol. Its IUPAC name is 1-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl benzoate.
| Compound Name | 1-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl benzoate |
|---|---|
| PubChem CID | 66951366 |
| Molecular Formula | C32H43NO10 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | 1-[[(2S)-3-[3,4-bis(2-methylbutan-2-yloxycarbonyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]propan-2-yl benzoate |
| SMILES | CCC(C)(C)OC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)c2ccccc2)C(=O)OC)cc1OC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C32H43NO10/c1-9-31(4,5)42-29(36)40-25-17-16-22(19-26(25)41-30(37)43-32(6,7)10-2)18-24(28(35)38-8)33-20-21(3)39-27(34)23-14-12-11-13-15-23/h11-17,19,21,24,33H,9-10,18,20H2,1-8H3/t21?,24-/m0/s1 |
| InChIKey | CDEVGNFWOMIYFZ-FHZUCYEKSA-N |
| XLogP | 6.01 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|