C31H41NO8 — CID 66944395
(2S)-2-(2-benzoyloxypropylamino)-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoic acid (PubChem CID 66944395) has the molecular formula C31H41NO8 and a molecular weight of 555.67 g/mol. Its IUPAC name is (2S)-2-(2-benzoyloxypropylamino)-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-(2-benzoyloxypropylamino)-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 66944395 |
| Molecular Formula | C31H41NO8 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (2S)-2-(2-benzoyloxypropylamino)-3-[3,4-bis(3-methylpentanoyloxy)phenyl]propanoic acid |
| SMILES | CCC(C)CC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)c2ccccc2)C(=O)O)cc1OC(=O)CC(C)CC |
| InChI | InChI=1S/C31H41NO8/c1-6-20(3)15-28(33)39-26-14-13-23(18-27(26)40-29(34)16-21(4)7-2)17-25(30(35)36)32-19-22(5)38-31(37)24-11-9-8-10-12-24/h8-14,18,20-22,25,32H,6-7,15-17,19H2,1-5H3,(H,35,36)/t20?,21?,22?,25-/m0/s1 |
| InChIKey | UZGFBSMUAYSJGN-DJYNTIJESA-N |
| XLogP | 5.20 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|