C27H41NO10 — CID 66945568
(2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoic acid (PubChem CID 66945568) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoic acid |
|---|---|
| PubChem CID | 66945568 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | (2S)-3-[3,4-bis(3-methylbutan-2-yloxycarbonyloxy)phenyl]-2-(2-propanoyloxypropylamino)propanoic acid |
| SMILES | CCC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)OC(C)C(C)C)c(OC(=O)OC(C)C(C)C)c1)C(=O)O |
| InChI | InChI=1S/C27H41NO10/c1-9-24(29)34-17(6)14-28-21(25(30)31)12-20-10-11-22(37-26(32)35-18(7)15(2)3)23(13-20)38-27(33)36-19(8)16(4)5/h10-11,13,15-19,21,28H,9,12,14H2,1-8H3,(H,30,31)/t17?,18?,19?,21-/m0/s1 |
| InChIKey | AVHGQYRRNIFARD-GJFGYCNFSA-N |
| XLogP | 4.73 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|