C26H39NO10 — CID 66946101
(2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2,3-dimethylbutanoyloxy)propylamino]propanoic acid (PubChem CID 66946101) has the molecular formula C26H39NO10 and a molecular weight of 525.60 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2,3-dimethylbutanoyloxy)propylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2,3-dimethylbutanoyloxy)propylamino]propanoic acid |
|---|---|
| PubChem CID | 66946101 |
| Molecular Formula | C26H39NO10 |
| Molecular Weight | 525.60 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2,3-dimethylbutanoyloxy)propylamino]propanoic acid |
| SMILES | CC(C)OC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)C(C)C)C(=O)O)cc1OC(=O)OC(C)C |
| InChI | InChI=1S/C26H39NO10/c1-14(2)18(8)24(30)35-17(7)13-27-20(23(28)29)11-19-9-10-21(36-25(31)33-15(3)4)22(12-19)37-26(32)34-16(5)6/h9-10,12,14-18,20,27H,11,13H2,1-8H3,(H,28,29)/t17?,18?,20-/m0/s1 |
| InChIKey | UBFPPWOPERHSOR-QLOJAFMTSA-N |
| XLogP | 4.34 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|