C24H35NO10 — CID 66943515
(2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid (PubChem CID 66943515) has the molecular formula C24H35NO10 and a molecular weight of 497.54 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid |
|---|---|
| PubChem CID | 66943515 |
| Molecular Formula | C24H35NO10 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (2S)-3-[3,4-bis(propan-2-yloxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid |
| SMILES | CC(C)OC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)C)C(=O)O)cc1OC(=O)OC(C)C |
| InChI | InChI=1S/C24H35NO10/c1-13(2)22(28)33-16(7)12-25-18(21(26)27)10-17-8-9-19(34-23(29)31-14(3)4)20(11-17)35-24(30)32-15(5)6/h8-9,11,13-16,18,25H,10,12H2,1-7H3,(H,26,27)/t16?,18-/m0/s1 |
| InChIKey | PHCLTZUOBQULGS-DAFXYXGESA-N |
| XLogP | 3.71 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|