C20H27NO10 — CID 66947755
(2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid (PubChem CID 66947755) has the molecular formula C20H27NO10 and a molecular weight of 441.43 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid |
|---|---|
| PubChem CID | 66947755 |
| Molecular Formula | C20H27NO10 |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (2S)-3-[3,4-bis(methoxycarbonyloxy)phenyl]-2-[2-(2-methylpropanoyloxy)propylamino]propanoic acid |
| SMILES | COC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)C(C)C)C(=O)O)cc1OC(=O)OC |
| InChI | InChI=1S/C20H27NO10/c1-11(2)18(24)29-12(3)10-21-14(17(22)23)8-13-6-7-15(30-19(25)27-4)16(9-13)31-20(26)28-5/h6-7,9,11-12,14,21H,8,10H2,1-5H3,(H,22,23)/t12?,14-/m0/s1 |
| InChIKey | MPTNDODCOOXFJW-PYMCNQPYSA-N |
| XLogP | 2.15 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|