C25H37NO11 — CID 66949320
(2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-butan-2-yloxycarbonyloxypropylamino)propanoic acid (PubChem CID 66949320) has the molecular formula C25H37NO11 and a molecular weight of 527.57 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-butan-2-yloxycarbonyloxypropylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-butan-2-yloxycarbonyloxypropylamino)propanoic acid |
|---|---|
| PubChem CID | 66949320 |
| Molecular Formula | C25H37NO11 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (2S)-3-[3,4-bis(propoxycarbonyloxy)phenyl]-2-(2-butan-2-yloxycarbonyloxypropylamino)propanoic acid |
| SMILES | CCCOC(=O)Oc1ccc(C[C@H](NCC(C)OC(=O)OC(C)CC)C(=O)O)cc1OC(=O)OCCC |
| InChI | InChI=1S/C25H37NO11/c1-6-11-32-23(29)36-20-10-9-18(14-21(20)37-24(30)33-12-7-2)13-19(22(27)28)26-15-17(5)35-25(31)34-16(4)8-3/h9-10,14,16-17,19,26H,6-8,11-13,15H2,1-5H3,(H,27,28)/t16?,17?,19-/m0/s1 |
| InChIKey | LMQUGIRHEPHQRE-TVPLGVNVSA-N |
| XLogP | 4.46 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|