C27H41NO9 — CID 66948133
(2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-butoxycarbonyloxypropylamino)propanoic acid (PubChem CID 66948133) has the molecular formula C27H41NO9 and a molecular weight of 523.62 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-butoxycarbonyloxypropylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-butoxycarbonyloxypropylamino)propanoic acid |
|---|---|
| PubChem CID | 66948133 |
| Molecular Formula | C27H41NO9 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-butoxycarbonyloxypropylamino)propanoic acid |
| SMILES | CCCCOC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)C(C)CC)c(OC(=O)C(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C27H41NO9/c1-7-10-13-34-27(33)35-19(6)16-28-21(24(29)30)14-20-11-12-22(36-25(31)17(4)8-2)23(15-20)37-26(32)18(5)9-3/h11-12,15,17-19,21,28H,7-10,13-14,16H2,1-6H3,(H,29,30)/t17?,18?,19?,21-/m0/s1 |
| InChIKey | RMCNFHHUGBRIPJ-GJFGYCNFSA-N |
| XLogP | 4.52 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|