C25H37NO9 — CID 66948060
(2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-ethoxycarbonyloxypropylamino)propanoic acid (PubChem CID 66948060) has the molecular formula C25H37NO9 and a molecular weight of 495.57 g/mol. Its IUPAC name is (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-ethoxycarbonyloxypropylamino)propanoic acid.
| Compound Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-ethoxycarbonyloxypropylamino)propanoic acid |
|---|---|
| PubChem CID | 66948060 |
| Molecular Formula | C25H37NO9 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | (2S)-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-2-(2-ethoxycarbonyloxypropylamino)propanoic acid |
| SMILES | CCOC(=O)OC(C)CN[C@@H](Cc1ccc(OC(=O)C(C)CC)c(OC(=O)C(C)CC)c1)C(=O)O |
| InChI | InChI=1S/C25H37NO9/c1-7-15(4)23(29)34-20-11-10-18(13-21(20)35-24(30)16(5)8-2)12-19(22(27)28)26-14-17(6)33-25(31)32-9-3/h10-11,13,15-17,19,26H,7-9,12,14H2,1-6H3,(H,27,28)/t15?,16?,17?,19-/m0/s1 |
| InChIKey | SRNCHSZLOYRXCE-QMUDONBSSA-N |
| XLogP | 3.74 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|